C16H22N2O5 — CID 110803371
methyl 4-[2-(2,5-dimethoxyphenyl)acetyl]piperazine-1-carboxylate (PubChem CID 110803371) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl 4-[2-(2,5-dimethoxyphenyl)acetyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[2-(2,5-dimethoxyphenyl)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110803371 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | methyl 4-[2-(2,5-dimethoxyphenyl)acetyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)Cc2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C16H22N2O5/c1-21-13-4-5-14(22-2)12(10-13)11-15(19)17-6-8-18(9-7-17)16(20)23-3/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | ASWPHTAWSBPZTH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |