C16H24N2O3 — CID 39948329
2-(2,4-dimethoxyphenyl)-1-(4-methyl-1,4-diazepan-1-yl)ethanone (PubChem CID 39948329) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-1-(4-methyl-1,4-diazepan-1-yl)ethanone.
| Compound Name | 2-(2,4-dimethoxyphenyl)-1-(4-methyl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 39948329 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-1-(4-methyl-1,4-diazepan-1-yl)ethanone |
| SMILES | COc1ccc(CC(=O)N2CCCN(C)CC2)c(OC)c1 |
| InChI | InChI=1S/C16H24N2O3/c1-17-7-4-8-18(10-9-17)16(19)11-13-5-6-14(20-2)12-15(13)21-3/h5-6,12H,4,7-11H2,1-3H3 |
| InChIKey | RZGRYOLOGHPCDF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |