C16H22N2O4 — CID 78821506
1-(4-acetylpiperazin-1-yl)-2-(2,5-dimethoxyphenyl)ethanone (PubChem CID 78821506) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-(4-acetylpiperazin-1-yl)-2-(2,5-dimethoxyphenyl)ethanone.
| Compound Name | 1-(4-acetylpiperazin-1-yl)-2-(2,5-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 78821506 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-(4-acetylpiperazin-1-yl)-2-(2,5-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(OC)c(CC(=O)N2CCN(C(C)=O)CC2)c1 |
| InChI | InChI=1S/C16H22N2O4/c1-12(19)17-6-8-18(9-7-17)16(20)11-13-10-14(21-2)4-5-15(13)22-3/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | OFTFVPIQIMCBSO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |