C20H22N4O4 — CID 133478136
3-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]-4-nitrobenzonitrile (PubChem CID 133478136) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]-4-nitrobenzonitrile.
| Compound Name | 3-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]-4-nitrobenzonitrile |
|---|---|
| PubChem CID | 133478136 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 3-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]-4-nitrobenzonitrile |
| SMILES | COc1ccc(OC)c(CN2CCN(c3cc(C#N)ccc3[N+](=O)[O-])CC2)c1 |
| InChI | InChI=1S/C20H22N4O4/c1-27-17-4-6-20(28-2)16(12-17)14-22-7-9-23(10-8-22)19-11-15(13-21)3-5-18(19)24(25)26/h3-6,11-12H,7-10,14H2,1-2H3 |
| InChIKey | CDHDAFYCJDWEMN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 91.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|