C20H19F3N4O2 — CID 133478681
4-nitro-3-[4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-1-yl]benzonitrile (PubChem CID 133478681) has the molecular formula C20H19F3N4O2 and a molecular weight of 404.39 g/mol. Its IUPAC name is 4-nitro-3-[4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-nitro-3-[4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 133478681 |
| Molecular Formula | C20H19F3N4O2 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-nitro-3-[4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccc([N+](=O)[O-])c(N2CCCN(Cc3ccc(C(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C20H19F3N4O2/c21-20(22,23)17-5-2-15(3-6-17)14-25-8-1-9-26(11-10-25)19-12-16(13-24)4-7-18(19)27(28)29/h2-7,12H,1,8-11,14H2 |
| InChIKey | FCZMQDHAFQSDJH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|