C24H25N5O7 — CID 3813656
N-[(3,4-dimethoxyphenyl)methyl]-N-(furan-2-ylmethyl)-5-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 3813656) has the molecular formula C24H25N5O7 and a molecular weight of 495.49 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-(furan-2-ylmethyl)-5-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-(furan-2-ylmethyl)-5-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 3813656 |
| Molecular Formula | C24H25N5O7 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-(furan-2-ylmethyl)-5-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | COc1ccc(CN(Cc2ccco2)c2cc(N3CCOCC3)c([N+](=O)[O-])c3nonc23)cc1OC |
| InChI | InChI=1S/C24H25N5O7/c1-32-20-6-5-16(12-21(20)33-2)14-28(15-17-4-3-9-35-17)18-13-19(27-7-10-34-11-8-27)24(29(30)31)23-22(18)25-36-26-23/h3-6,9,12-13H,7-8,10-11,14-15H2,1-2H3 |
| InChIKey | RDWWUDYUNUVRRV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 129.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|