C20H29N5O5 — CID 5131607
N-[(3,4-dimethoxyphenyl)methyl]-3-methyl-N-(3-morpholin-4-ylpropyl)-5-nitroimidazol-4-amine (PubChem CID 5131607) has the molecular formula C20H29N5O5 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-3-methyl-N-(3-morpholin-4-ylpropyl)-5-nitroimidazol-4-amine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-3-methyl-N-(3-morpholin-4-ylpropyl)-5-nitroimidazol-4-amine |
|---|---|
| PubChem CID | 5131607 |
| Molecular Formula | C20H29N5O5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-3-methyl-N-(3-morpholin-4-ylpropyl)-5-nitroimidazol-4-amine |
| SMILES | COc1ccc(CN(CCCN2CCOCC2)c2c([N+](=O)[O-])ncn2C)cc1OC |
| InChI | InChI=1S/C20H29N5O5/c1-22-15-21-19(25(26)27)20(22)24(8-4-7-23-9-11-30-12-10-23)14-16-5-6-17(28-2)18(13-16)29-3/h5-6,13,15H,4,7-12,14H2,1-3H3 |
| InChIKey | COLGJDWPMUYWAH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 95.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|