C19H28N6O5 — CID 3839973
N-[(2,3-dimethoxyphenyl)methyl]-2-methyl-N-(3-morpholin-4-ylpropyl)-5-nitro-1,2,4-triazol-3-amine (PubChem CID 3839973) has the molecular formula C19H28N6O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-2-methyl-N-(3-morpholin-4-ylpropyl)-5-nitro-1,2,4-triazol-3-amine.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-2-methyl-N-(3-morpholin-4-ylpropyl)-5-nitro-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 3839973 |
| Molecular Formula | C19H28N6O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-2-methyl-N-(3-morpholin-4-ylpropyl)-5-nitro-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(CN(CCCN2CCOCC2)c2nc([N+](=O)[O-])nn2C)c1OC |
| InChI | InChI=1S/C19H28N6O5/c1-22-19(20-18(21-22)25(26)27)24(9-5-8-23-10-12-30-13-11-23)14-15-6-4-7-16(28-2)17(15)29-3/h4,6-7H,5,8-14H2,1-3H3 |
| InChIKey | CFMWGKAEBLZQAB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 108.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|