C31H46N2O5 — CID 124894899
(3S,3aS,4aR,8aR,9aS)-3-[[(2,3-dimethoxyphenyl)methyl-(3-morpholin-4-ylpropyl)amino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one (PubChem CID 124894899) has the molecular formula C31H46N2O5 and a molecular weight of 526.72 g/mol. Its IUPAC name is (3S,3aS,4aR,8aR,9aS)-3-[[(2,3-dimethoxyphenyl)methyl-(3-morpholin-4-ylpropyl)amino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aS,4aR,8aR,9aS)-3-[[(2,3-dimethoxyphenyl)methyl-(3-morpholin-4-ylpropyl)amino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 124894899 |
| Molecular Formula | C31H46N2O5 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | (3S,3aS,4aR,8aR,9aS)-3-[[(2,3-dimethoxyphenyl)methyl-(3-morpholin-4-ylpropyl)amino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
| SMILES | C=C1CCC[C@]2(C)C[C@@H]3OC(=O)[C@H](CN(CCCN4CCOCC4)Cc4cccc(OC)c4OC)[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C31H46N2O5/c1-22-8-6-11-31(2)19-28-24(18-26(22)31)25(30(34)38-28)21-33(13-7-12-32-14-16-37-17-15-32)20-23-9-5-10-27(35-3)29(23)36-4/h5,9-10,24-26,28H,1,6-8,11-21H2,2-4H3/t24-,25+,26+,28-,31+/m0/s1 |
| InChIKey | VPSXFBMPWJDTHT-CAIRVTJKSA-N |
| XLogP | 4.54 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|