C29H37NO4 — CID 163075492
(3S,3aS,4aS,8aR,9aR)-3-[[[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-methylamino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one (PubChem CID 163075492) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is (3S,3aS,4aS,8aR,9aR)-3-[[[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-methylamino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aS,4aS,8aR,9aR)-3-[[[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-methylamino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 163075492 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | (3S,3aS,4aS,8aR,9aR)-3-[[[(2S)-2-hydroxy-3-naphthalen-1-yloxypropyl]-methylamino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
| SMILES | C=C1CCC[C@]2(C)C[C@H]3OC(=O)[C@H](CN(C)C[C@H](O)COc4cccc5ccccc45)[C@@H]3C[C@@H]12 |
| InChI | InChI=1S/C29H37NO4/c1-19-8-7-13-29(2)15-27-23(14-25(19)29)24(28(32)34-27)17-30(3)16-21(31)18-33-26-12-6-10-20-9-4-5-11-22(20)26/h4-6,9-12,21,23-25,27,31H,1,7-8,13-18H2,2-3H3/t21-,23-,24+,25-,27+,29+/m0/s1 |
| InChIKey | AYWGUJVWIMXXNN-ONOUACOCSA-N |
| XLogP | 4.83 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|