C22H21N5O3 — CID 3511599
7-N,7-N-dibenzyl-5-N,5-N-dimethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine (PubChem CID 3511599) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 7-N,7-N-dibenzyl-5-N,5-N-dimethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine.
| Compound Name | 7-N,7-N-dibenzyl-5-N,5-N-dimethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine |
|---|---|
| PubChem CID | 3511599 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 7-N,7-N-dibenzyl-5-N,5-N-dimethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine |
| SMILES | CN(C)c1cc(N(Cc2ccccc2)Cc2ccccc2)c2nonc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H21N5O3/c1-25(2)19-13-18(20-21(24-30-23-20)22(19)27(28)29)26(14-16-9-5-3-6-10-16)15-17-11-7-4-8-12-17/h3-13H,14-15H2,1-2H3 |
| InChIKey | JLHROAUYQZZSQR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 88.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|