C20H17N3O4 — CID 7237184
N,N-dibenzyl-3,5-dinitroaniline (PubChem CID 7237184) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is N,N-dibenzyl-3,5-dinitroaniline.
| Compound Name | N,N-dibenzyl-3,5-dinitroaniline |
|---|---|
| PubChem CID | 7237184 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N,N-dibenzyl-3,5-dinitroaniline |
| SMILES | O=[N+]([O-])c1cc(N(Cc2ccccc2)Cc2ccccc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17N3O4/c24-22(25)19-11-18(12-20(13-19)23(26)27)21(14-16-7-3-1-4-8-16)15-17-9-5-2-6-10-17/h1-13H,14-15H2 |
| InChIKey | QWEZHFQDNXOZRM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|