C22H22N2O2 — CID 11057117
N,N-dibenzyl-2-(4-nitrophenyl)ethanamine (PubChem CID 11057117) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is N,N-dibenzyl-2-(4-nitrophenyl)ethanamine.
| Compound Name | N,N-dibenzyl-2-(4-nitrophenyl)ethanamine |
|---|---|
| PubChem CID | 11057117 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N,N-dibenzyl-2-(4-nitrophenyl)ethanamine |
| SMILES | O=[N+]([O-])c1ccc(CCN(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N2O2/c25-24(26)22-13-11-19(12-14-22)15-16-23(17-20-7-3-1-4-8-20)18-21-9-5-2-6-10-21/h1-14H,15-18H2 |
| InChIKey | FHYTVPKOAIWCHX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|