C27H26N2O2 — CID 23881077
N-(naphthalen-2-ylmethyl)-N-[(4-nitrophenyl)methyl]-3-phenylpropan-1-amine (PubChem CID 23881077) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-(naphthalen-2-ylmethyl)-N-[(4-nitrophenyl)methyl]-3-phenylpropan-1-amine.
| Compound Name | N-(naphthalen-2-ylmethyl)-N-[(4-nitrophenyl)methyl]-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 23881077 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-(naphthalen-2-ylmethyl)-N-[(4-nitrophenyl)methyl]-3-phenylpropan-1-amine |
| SMILES | O=[N+]([O-])c1ccc(CN(CCCc2ccccc2)Cc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C27H26N2O2/c30-29(31)27-16-13-23(14-17-27)20-28(18-6-9-22-7-2-1-3-8-22)21-24-12-15-25-10-4-5-11-26(25)19-24/h1-5,7-8,10-17,19H,6,9,18,20-21H2 |
| InChIKey | ZQGCZLBSFXGACT-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|