C31H32N2O4 — CID 23794044
N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-[(3-nitrophenyl)methyl]-3-phenylpropan-1-amine (PubChem CID 23794044) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-[(3-nitrophenyl)methyl]-3-phenylpropan-1-amine.
| Compound Name | N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-[(3-nitrophenyl)methyl]-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 23794044 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-N-[(3-nitrophenyl)methyl]-3-phenylpropan-1-amine |
| SMILES | COc1cc(CN(CCCc2ccccc2)Cc2cccc([N+](=O)[O-])c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C31H32N2O4/c1-36-31-21-28(17-18-30(31)37-24-26-12-6-3-7-13-26)23-32(19-9-15-25-10-4-2-5-11-25)22-27-14-8-16-29(20-27)33(34)35/h2-8,10-14,16-18,20-21H,9,15,19,22-24H2,1H3 |
| InChIKey | ONMIESHTYALEFN-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|