C26H29N3O5 — CID 42705090
1-butyl-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-(4-nitrophenyl)urea (PubChem CID 42705090) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is 1-butyl-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-butyl-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 42705090 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 1-butyl-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-(4-nitrophenyl)urea |
| SMILES | CCCCN(Cc1ccc(OCc2ccccc2)c(OC)c1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H29N3O5/c1-3-4-16-28(26(30)27-22-11-13-23(14-12-22)29(31)32)18-21-10-15-24(25(17-21)33-2)34-19-20-8-6-5-7-9-20/h5-15,17H,3-4,16,18-19H2,1-2H3,(H,27,30) |
| InChIKey | LJQYQDZCLIQVIZ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|