C27H39NO3 — CID 42705071
N-butyl-2-ethyl-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]hexanamide (PubChem CID 42705071) has the molecular formula C27H39NO3 and a molecular weight of 425.61 g/mol. Its IUPAC name is N-butyl-2-ethyl-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]hexanamide.
| Compound Name | N-butyl-2-ethyl-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]hexanamide |
|---|---|
| PubChem CID | 42705071 |
| Molecular Formula | C27H39NO3 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | N-butyl-2-ethyl-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]hexanamide |
| SMILES | CCCCC(CC)C(=O)N(CCCC)Cc1ccc(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C27H39NO3/c1-5-8-15-24(7-3)27(29)28(18-9-6-2)20-23-16-17-25(26(19-23)30-4)31-21-22-13-11-10-12-14-22/h10-14,16-17,19,24H,5-9,15,18,20-21H2,1-4H3 |
| InChIKey | DVCSJJWEJWRGTR-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |