C29H45N3O3 — CID 42708399
3-butyl-1-[5-(diethylamino)pentan-2-yl]-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea (PubChem CID 42708399) has the molecular formula C29H45N3O3 and a molecular weight of 483.70 g/mol. Its IUPAC name is 3-butyl-1-[5-(diethylamino)pentan-2-yl]-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea.
| Compound Name | 3-butyl-1-[5-(diethylamino)pentan-2-yl]-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 42708399 |
| Molecular Formula | C29H45N3O3 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | 3-butyl-1-[5-(diethylamino)pentan-2-yl]-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea |
| SMILES | CCCCNC(=O)N(Cc1ccc(OCc2ccccc2)c(OC)c1)C(C)CCCN(CC)CC |
| InChI | InChI=1S/C29H45N3O3/c1-6-9-19-30-29(33)32(24(4)14-13-20-31(7-2)8-3)22-26-17-18-27(28(21-26)34-5)35-23-25-15-11-10-12-16-25/h10-12,15-18,21,24H,6-9,13-14,19-20,22-23H2,1-5H3,(H,30,33) |
| InChIKey | NBYBPSNUAKUQQO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|