C28H43N3O — CID 42704635
3-benzyl-1-[(4-tert-butylphenyl)methyl]-1-[5-(diethylamino)pentan-2-yl]urea (PubChem CID 42704635) has the molecular formula C28H43N3O and a molecular weight of 437.67 g/mol. Its IUPAC name is 3-benzyl-1-[(4-tert-butylphenyl)methyl]-1-[5-(diethylamino)pentan-2-yl]urea.
| Compound Name | 3-benzyl-1-[(4-tert-butylphenyl)methyl]-1-[5-(diethylamino)pentan-2-yl]urea |
|---|---|
| PubChem CID | 42704635 |
| Molecular Formula | C28H43N3O |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.34 |
| IUPAC Name | 3-benzyl-1-[(4-tert-butylphenyl)methyl]-1-[5-(diethylamino)pentan-2-yl]urea |
| SMILES | CCN(CC)CCCC(C)N(Cc1ccc(C(C)(C)C)cc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C28H43N3O/c1-7-30(8-2)20-12-13-23(3)31(27(32)29-21-24-14-10-9-11-15-24)22-25-16-18-26(19-17-25)28(4,5)6/h9-11,14-19,23H,7-8,12-13,20-22H2,1-6H3,(H,29,32) |
| InChIKey | IZTHHWKDCSBWJH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |