C23H31Cl2N3O — CID 42695686
1-benzyl-3-(3,4-dichlorophenyl)-1-[5-(diethylamino)pentan-2-yl]urea (PubChem CID 42695686) has the molecular formula C23H31Cl2N3O and a molecular weight of 436.43 g/mol. Its IUPAC name is 1-benzyl-3-(3,4-dichlorophenyl)-1-[5-(diethylamino)pentan-2-yl]urea.
| Compound Name | 1-benzyl-3-(3,4-dichlorophenyl)-1-[5-(diethylamino)pentan-2-yl]urea |
|---|---|
| PubChem CID | 42695686 |
| Molecular Formula | C23H31Cl2N3O |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-benzyl-3-(3,4-dichlorophenyl)-1-[5-(diethylamino)pentan-2-yl]urea |
| SMILES | CCN(CC)CCCC(C)N(Cc1ccccc1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H31Cl2N3O/c1-4-27(5-2)15-9-10-18(3)28(17-19-11-7-6-8-12-19)23(29)26-20-13-14-21(24)22(25)16-20/h6-8,11-14,16,18H,4-5,9-10,15,17H2,1-3H3,(H,26,29) |
| InChIKey | YLHMRSXLDPEZRO-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |