C23H34N2 — CID 155935553
(4S)-4-N,4-N-dibenzyl-1-N,1-N-diethylpentane-1,4-diamine (PubChem CID 155935553) has the molecular formula C23H34N2 and a molecular weight of 338.54 g/mol. Its IUPAC name is (4S)-4-N,4-N-dibenzyl-1-N,1-N-diethylpentane-1,4-diamine.
| Compound Name | (4S)-4-N,4-N-dibenzyl-1-N,1-N-diethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 155935553 |
| Molecular Formula | C23H34N2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | (4S)-4-N,4-N-dibenzyl-1-N,1-N-diethylpentane-1,4-diamine |
| SMILES | CCN(CC)CCC[C@H](C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H34N2/c1-4-24(5-2)18-12-13-21(3)25(19-22-14-8-6-9-15-22)20-23-16-10-7-11-17-23/h6-11,14-17,21H,4-5,12-13,18-20H2,1-3H3/t21-/m0/s1 |
| InChIKey | QOCFZCKKVYTCJB-NRFANRHFSA-N |
| XLogP | 5.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |