C22H31BrN2O2S — CID 42695693
N-benzyl-4-bromo-N-[5-(diethylamino)pentan-2-yl]benzenesulfonamide (PubChem CID 42695693) has the molecular formula C22H31BrN2O2S and a molecular weight of 467.47 g/mol. Its IUPAC name is N-benzyl-4-bromo-N-[5-(diethylamino)pentan-2-yl]benzenesulfonamide.
| Compound Name | N-benzyl-4-bromo-N-[5-(diethylamino)pentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 42695693 |
| Molecular Formula | C22H31BrN2O2S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | N-benzyl-4-bromo-N-[5-(diethylamino)pentan-2-yl]benzenesulfonamide |
| SMILES | CCN(CC)CCCC(C)N(Cc1ccccc1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H31BrN2O2S/c1-4-24(5-2)17-9-10-19(3)25(18-20-11-7-6-8-12-20)28(26,27)22-15-13-21(23)14-16-22/h6-8,11-16,19H,4-5,9-10,17-18H2,1-3H3 |
| InChIKey | MXKCRXKZIFXWDU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |