C26H40N2O2S — CID 42704638
N-[(4-tert-butylphenyl)methyl]-N-[5-(diethylamino)pentan-2-yl]benzenesulfonamide (PubChem CID 42704638) has the molecular formula C26H40N2O2S and a molecular weight of 444.69 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-N-[5-(diethylamino)pentan-2-yl]benzenesulfonamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-N-[5-(diethylamino)pentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 42704638 |
| Molecular Formula | C26H40N2O2S |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-N-[5-(diethylamino)pentan-2-yl]benzenesulfonamide |
| SMILES | CCN(CC)CCCC(C)N(Cc1ccc(C(C)(C)C)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H40N2O2S/c1-7-27(8-2)20-12-13-22(3)28(31(29,30)25-14-10-9-11-15-25)21-23-16-18-24(19-17-23)26(4,5)6/h9-11,14-19,22H,7-8,12-13,20-21H2,1-6H3 |
| InChIKey | UOICYMUIGCEASI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |