C30H54N2O — CID 5115616
N-[(4-tert-butylphenyl)methyl]-N-[5-(diethylamino)pentan-2-yl]decanamide (PubChem CID 5115616) has the molecular formula C30H54N2O and a molecular weight of 458.78 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-N-[5-(diethylamino)pentan-2-yl]decanamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-N-[5-(diethylamino)pentan-2-yl]decanamide |
|---|---|
| PubChem CID | 5115616 |
| Molecular Formula | C30H54N2O |
| Molecular Weight | 458.78 g/mol |
| Exact Mass | 458.42 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-N-[5-(diethylamino)pentan-2-yl]decanamide |
| SMILES | CCCCCCCCCC(=O)N(Cc1ccc(C(C)(C)C)cc1)C(C)CCCN(CC)CC |
| InChI | InChI=1S/C30H54N2O/c1-8-11-12-13-14-15-16-19-29(33)32(26(4)18-17-24-31(9-2)10-3)25-27-20-22-28(23-21-27)30(5,6)7/h20-23,26H,8-19,24-25H2,1-7H3 |
| InChIKey | QUVMPWKDYPHUFT-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.78 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|