C22H40N4O3 — CID 5097311
N-[5-(diethylamino)pentan-2-yl]-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]heptanamide (PubChem CID 5097311) has the molecular formula C22H40N4O3 and a molecular weight of 408.59 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]heptanamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]heptanamide |
|---|---|
| PubChem CID | 5097311 |
| Molecular Formula | C22H40N4O3 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]heptanamide |
| SMILES | CCCCCCC(=O)N(CC(=O)Nc1cc(C)on1)C(C)CCCN(CC)CC |
| InChI | InChI=1S/C22H40N4O3/c1-6-9-10-11-14-22(28)26(18(4)13-12-15-25(7-2)8-3)17-21(27)23-20-16-19(5)29-24-20/h16,18H,6-15,17H2,1-5H3,(H,23,24,27) |
| InChIKey | WBCFFJUDWTYOLZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|