C23H42N4O3 — CID 5168715
N-[5-(diethylamino)pentan-2-yl]-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]octanamide (PubChem CID 5168715) has the molecular formula C23H42N4O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]octanamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]octanamide |
|---|---|
| PubChem CID | 5168715 |
| Molecular Formula | C23H42N4O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.33 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]octanamide |
| SMILES | CCCCCCCC(=O)N(CC(=O)Nc1cc(C)on1)C(C)CCCN(CC)CC |
| InChI | InChI=1S/C23H42N4O3/c1-6-9-10-11-12-15-23(29)27(19(4)14-13-16-26(7-2)8-3)18-22(28)24-21-17-20(5)30-25-21/h17,19H,6-16,18H2,1-5H3,(H,24,25,28) |
| InChIKey | PBAQHRGTPJYSTI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|