C20H36N4O3 — CID 42664092
N-[2-(dimethylamino)ethyl]-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]decanamide (PubChem CID 42664092) has the molecular formula C20H36N4O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]decanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]decanamide |
|---|---|
| PubChem CID | 42664092 |
| Molecular Formula | C20H36N4O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]decanamide |
| SMILES | CCCCCCCCCC(=O)N(CCN(C)C)CC(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C20H36N4O3/c1-5-6-7-8-9-10-11-12-20(26)24(14-13-23(3)4)16-19(25)21-18-15-17(2)27-22-18/h15H,5-14,16H2,1-4H3,(H,21,22,25) |
| InChIKey | YHOKBNFOXYSSIF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|