C19H32N4O4 — CID 5007579
N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)hexanamide (PubChem CID 5007579) has the molecular formula C19H32N4O4 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)hexanamide.
| Compound Name | N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)hexanamide |
|---|---|
| PubChem CID | 5007579 |
| Molecular Formula | C19H32N4O4 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)hexanamide |
| SMILES | CCCCCC(=O)N(CCCN1CCOCC1)CC(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C19H32N4O4/c1-3-4-5-7-19(25)23(9-6-8-22-10-12-26-13-11-22)15-18(24)20-17-14-16(2)27-21-17/h14H,3-13,15H2,1-2H3,(H,20,21,24) |
| InChIKey | GWMKAZAGTHXMHQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|