C19H33N4O3+ — CID 7297527
N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-N-(2-piperidin-1-ium-1-ylethyl)hexanamide (PubChem CID 7297527) has the molecular formula C19H33N4O3+ and a molecular weight of 365.50 g/mol. Its IUPAC name is N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-N-(2-piperidin-1-ium-1-ylethyl)hexanamide.
| Compound Name | N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-N-(2-piperidin-1-ium-1-ylethyl)hexanamide |
|---|---|
| PubChem CID | 7297527 |
| Molecular Formula | C19H33N4O3+ |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-N-(2-piperidin-1-ium-1-ylethyl)hexanamide |
| SMILES | CCCCCC(=O)N(CC[NH+]1CCCCC1)CC(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C19H32N4O3/c1-3-4-6-9-19(25)23(13-12-22-10-7-5-8-11-22)15-18(24)20-17-14-16(2)26-21-17/h14H,3-13,15H2,1-2H3,(H,20,21,24)/p+1 |
| InChIKey | VRAGVBFMLSKKHI-UHFFFAOYSA-O |
| XLogP | 1.40 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|