C15H26N4O3 — CID 4547465
2-[dimethylcarbamoyl(hexyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 4547465) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-[dimethylcarbamoyl(hexyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[dimethylcarbamoyl(hexyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 4547465 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 2-[dimethylcarbamoyl(hexyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | CCCCCCN(CC(=O)Nc1cc(C)on1)C(=O)N(C)C |
| InChI | InChI=1S/C15H26N4O3/c1-5-6-7-8-9-19(15(21)18(3)4)11-14(20)16-13-10-12(2)22-17-13/h10H,5-9,11H2,1-4H3,(H,16,17,20) |
| InChIKey | JZSMTQXHJDAZFF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|