C31H44N2O2 — CID 42725308
N-[(4-tert-butylphenyl)methyl]-N-(1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl)heptanamide (PubChem CID 42725308) has the molecular formula C31H44N2O2 and a molecular weight of 476.71 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-N-(1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl)heptanamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-N-(1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl)heptanamide |
|---|---|
| PubChem CID | 42725308 |
| Molecular Formula | C31H44N2O2 |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.34 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-N-(1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl)heptanamide |
| SMILES | CCCCCCC(=O)N(Cc1ccc(C(C)(C)C)cc1)C(Cc1ccccc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C31H44N2O2/c1-5-6-7-11-16-29(34)33(24-26-17-19-27(20-18-26)31(2,3)4)28(23-25-14-9-8-10-15-25)30(35)32-21-12-13-22-32/h8-10,14-15,17-20,28H,5-7,11-13,16,21-24H2,1-4H3 |
| InChIKey | GSQSULHJZSFIRC-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|