C41H44F3N3O2 — CID 59808315
(E)-N-[(2S)-1-oxo-3-phenyl-1-(4-phenylpiperazin-1-yl)propan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 59808315) has the molecular formula C41H44F3N3O2 and a molecular weight of 667.82 g/mol. Its IUPAC name is (E)-N-[(2S)-1-oxo-3-phenyl-1-(4-phenylpiperazin-1-yl)propan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(2S)-1-oxo-3-phenyl-1-(4-phenylpiperazin-1-yl)propan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59808315 |
| Molecular Formula | C41H44F3N3O2 |
| Molecular Weight | 667.82 g/mol |
| Exact Mass | 667.34 |
| IUPAC Name | (E)-N-[(2S)-1-oxo-3-phenyl-1-(4-phenylpiperazin-1-yl)propan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCCCCc1ccc(CN(C(=O)/C=C/c2ccc(C(F)(F)F)cc2)[C@@H](Cc2ccccc2)C(=O)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C41H44F3N3O2/c1-2-3-6-11-32-16-18-35(19-17-32)31-47(39(48)25-22-33-20-23-36(24-21-33)41(42,43)44)38(30-34-12-7-4-8-13-34)40(49)46-28-26-45(27-29-46)37-14-9-5-10-15-37/h4-5,7-10,12-25,38H,2-3,6,11,26-31H2,1H3/b25-22+/t38-/m0/s1 |
| InChIKey | PZGWMUXXFYVPOK-FUYRGRPZSA-N |
| XLogP | 8.44 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.82 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|