C43H45F3N4O2 — CID 90779079
N-[(2S)-1-(4-benzylpiperazin-1-yl)-3-(4-isocyanophenyl)-1-oxopropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 90779079) has the molecular formula C43H45F3N4O2 and a molecular weight of 706.85 g/mol. Its IUPAC name is N-[(2S)-1-(4-benzylpiperazin-1-yl)-3-(4-isocyanophenyl)-1-oxopropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[(2S)-1-(4-benzylpiperazin-1-yl)-3-(4-isocyanophenyl)-1-oxopropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90779079 |
| Molecular Formula | C43H45F3N4O2 |
| Molecular Weight | 706.85 g/mol |
| Exact Mass | 706.35 |
| IUPAC Name | N-[(2S)-1-(4-benzylpiperazin-1-yl)-3-(4-isocyanophenyl)-1-oxopropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | [C-]#[N+]c1ccc(C[C@@H](C(=O)N2CCN(Cc3ccccc3)CC2)N(Cc2ccc(CCCCC)cc2)C(=O)C=Cc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C43H45F3N4O2/c1-3-4-6-9-33-12-14-37(15-13-33)32-50(41(51)25-20-34-16-21-38(22-17-34)43(44,45)46)40(30-35-18-23-39(47-2)24-19-35)42(52)49-28-26-48(27-29-49)31-36-10-7-5-8-11-36/h5,7-8,10-25,40H,3-4,6,9,26-32H2,1H3/t40-/m0/s1 |
| InChIKey | KPVJKHGJXPKNAW-FAIXQHPJSA-N |
| XLogP | 8.99 |
| TPSA | 48.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.85 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|