C37H36F3N3O2 — CID 91142852
N-benzyl-N-[1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 91142852) has the molecular formula C37H36F3N3O2 and a molecular weight of 611.71 g/mol. Its IUPAC name is N-benzyl-N-[1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-benzyl-N-[1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 91142852 |
| Molecular Formula | C37H36F3N3O2 |
| Molecular Weight | 611.71 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | N-benzyl-N-[1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(C(Cc1ccccc1)N(Cc1ccccc1)C(=O)C=Cc1ccc(C(F)(F)F)cc1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C37H36F3N3O2/c38-37(39,40)33-19-16-29(17-20-33)18-21-35(44)43(28-32-14-8-3-9-15-32)34(26-30-10-4-1-5-11-30)36(45)42-24-22-41(23-25-42)27-31-12-6-2-7-13-31/h1-21,34H,22-28H2 |
| InChIKey | MJFHEWVOHDVXSH-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.71 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|