C41H44BrF3N4O2 — CID 91458421
N-[(2S)-1-[4-[(6-bromo-3-pyridinyl)methyl]piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 91458421) has the molecular formula C41H44BrF3N4O2 and a molecular weight of 761.73 g/mol. Its IUPAC name is N-[(2S)-1-[4-[(6-bromo-3-pyridinyl)methyl]piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[(2S)-1-[4-[(6-bromo-3-pyridinyl)methyl]piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 91458421 |
| Molecular Formula | C41H44BrF3N4O2 |
| Molecular Weight | 761.73 g/mol |
| Exact Mass | 760.26 |
| IUPAC Name | N-[(2S)-1-[4-[(6-bromo-3-pyridinyl)methyl]piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCCCCc1ccc(CN(C(=O)C=Cc2ccc(C(F)(F)F)cc2)[C@@H](Cc2ccccc2)C(=O)N2CCN(Cc3ccc(Br)nc3)CC2)cc1 |
| InChI | InChI=1S/C41H44BrF3N4O2/c1-2-3-5-8-31-11-13-34(14-12-31)30-49(39(50)22-18-32-15-19-36(20-16-32)41(43,44)45)37(27-33-9-6-4-7-10-33)40(51)48-25-23-47(24-26-48)29-35-17-21-38(42)46-28-35/h4,6-7,9-22,28,37H,2-3,5,8,23-27,29-30H2,1H3/t37-/m0/s1 |
| InChIKey | MYINUQRHPZTBGL-QNGWXLTQSA-N |
| XLogP | 8.59 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.73 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|