C41H45F3N4O2 — CID 91284460
N-[(2S)-1-(4-benzylpiperazin-1-yl)-1-oxo-3-pyridin-2-ylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 91284460) has the molecular formula C41H45F3N4O2 and a molecular weight of 682.83 g/mol. Its IUPAC name is N-[(2S)-1-(4-benzylpiperazin-1-yl)-1-oxo-3-pyridin-2-ylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[(2S)-1-(4-benzylpiperazin-1-yl)-1-oxo-3-pyridin-2-ylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 91284460 |
| Molecular Formula | C41H45F3N4O2 |
| Molecular Weight | 682.83 g/mol |
| Exact Mass | 682.35 |
| IUPAC Name | N-[(2S)-1-(4-benzylpiperazin-1-yl)-1-oxo-3-pyridin-2-ylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCCCCc1ccc(CN(C(=O)C=Cc2ccc(C(F)(F)F)cc2)[C@@H](Cc2ccccn2)C(=O)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C41H45F3N4O2/c1-2-3-5-10-32-14-16-35(17-15-32)31-48(39(49)23-20-33-18-21-36(22-19-33)41(42,43)44)38(29-37-13-8-9-24-45-37)40(50)47-27-25-46(26-28-47)30-34-11-6-4-7-12-34/h4,6-9,11-24,38H,2-3,5,10,25-31H2,1H3/t38-/m0/s1 |
| InChIKey | UHRGVXJUDDRVIL-LHEWISCISA-N |
| XLogP | 7.83 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.83 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|