C40H43F3N4O2 — CID 59808289
(E)-N-[(2S)-1-oxo-3-phenyl-1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 59808289) has the molecular formula C40H43F3N4O2 and a molecular weight of 668.80 g/mol. Its IUPAC name is (E)-N-[(2S)-1-oxo-3-phenyl-1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(2S)-1-oxo-3-phenyl-1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59808289 |
| Molecular Formula | C40H43F3N4O2 |
| Molecular Weight | 668.80 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | (E)-N-[(2S)-1-oxo-3-phenyl-1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCCCCc1ccc(CN(C(=O)/C=C/c2ccc(C(F)(F)F)cc2)[C@@H](Cc2ccccc2)C(=O)N2CCN(c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C40H43F3N4O2/c1-2-3-5-10-31-14-16-34(17-15-31)30-47(38(48)23-20-32-18-21-35(22-19-32)40(41,42)43)36(29-33-11-6-4-7-12-33)39(49)46-27-25-45(26-28-46)37-13-8-9-24-44-37/h4,6-9,11-24,36H,2-3,5,10,25-30H2,1H3/b23-20+/t36-/m0/s1 |
| InChIKey | IXBDUANLLUCTBT-ARURXGCDSA-N |
| XLogP | 7.84 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.80 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|