C42H46F3N3O3 — CID 90842308
N-[(2S)-1-[4-(3-methoxyphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 90842308) has the molecular formula C42H46F3N3O3 and a molecular weight of 697.84 g/mol. Its IUPAC name is N-[(2S)-1-[4-(3-methoxyphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[(2S)-1-[4-(3-methoxyphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90842308 |
| Molecular Formula | C42H46F3N3O3 |
| Molecular Weight | 697.84 g/mol |
| Exact Mass | 697.35 |
| IUPAC Name | N-[(2S)-1-[4-(3-methoxyphenyl)piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCCCCc1ccc(CN(C(=O)C=Cc2cccc(C(F)(F)F)c2)[C@@H](Cc2ccccc2)C(=O)N2CCN(c3cccc(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C42H46F3N3O3/c1-3-4-6-11-32-18-20-35(21-19-32)31-48(40(49)23-22-34-14-9-15-36(28-34)42(43,44)45)39(29-33-12-7-5-8-13-33)41(50)47-26-24-46(25-27-47)37-16-10-17-38(30-37)51-2/h5,7-10,12-23,28,30,39H,3-4,6,11,24-27,29,31H2,1-2H3/t39-/m0/s1 |
| InChIKey | CLTZBDDBCKTRNV-KDXMTYKHSA-N |
| XLogP | 8.45 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.84 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|