C44H55N3O3 — CID 143444461
(E)-N-[(2S)-1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(3-methoxyphenyl)-N-[(4-pentylphenyl)methyl]prop-2-enamide;ethane (PubChem CID 143444461) has the molecular formula C44H55N3O3 and a molecular weight of 673.94 g/mol. Its IUPAC name is (E)-N-[(2S)-1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(3-methoxyphenyl)-N-[(4-pentylphenyl)methyl]prop-2-enamide;ethane.
| Compound Name | (E)-N-[(2S)-1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(3-methoxyphenyl)-N-[(4-pentylphenyl)methyl]prop-2-enamide;ethane |
|---|---|
| PubChem CID | 143444461 |
| Molecular Formula | C44H55N3O3 |
| Molecular Weight | 673.94 g/mol |
| Exact Mass | 673.42 |
| IUPAC Name | (E)-N-[(2S)-1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-3-(3-methoxyphenyl)-N-[(4-pentylphenyl)methyl]prop-2-enamide;ethane |
| SMILES | CC.CCCCCc1ccc(CN(C(=O)/C=C/c2cccc(OC)c2)[C@@H](Cc2ccccc2)C(=O)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C42H49N3O3.C2H6/c1-3-4-7-13-34-20-22-38(23-21-34)33-45(41(46)25-24-36-18-12-19-39(30-36)48-2)40(31-35-14-8-5-9-15-35)42(47)44-28-26-43(27-29-44)32-37-16-10-6-11-17-37;1-2/h5-6,8-12,14-25,30,40H,3-4,7,13,26-29,31-33H2,1-2H3;1-2H3/b25-24+;/t40-;/m0./s1 |
| InChIKey | LZHCAJSTQYZPCR-BHGXZDFWSA-N |
| XLogP | 8.45 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.94 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|