C36H40F3N3O3 — CID 72567381
N-[1-(4-formylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 72567381) has the molecular formula C36H40F3N3O3 and a molecular weight of 619.73 g/mol. Its IUPAC name is N-[1-(4-formylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[1-(4-formylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 72567381 |
| Molecular Formula | C36H40F3N3O3 |
| Molecular Weight | 619.73 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | N-[1-(4-formylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCCCCc1ccc(CN(C(=O)C=Cc2ccc(C(F)(F)F)cc2)C(Cc2ccccc2)C(=O)N2CCN(C=O)CC2)cc1 |
| InChI | InChI=1S/C36H40F3N3O3/c1-2-3-5-8-28-11-13-31(14-12-28)26-42(34(44)20-17-29-15-18-32(19-16-29)36(37,38)39)33(25-30-9-6-4-7-10-30)35(45)41-23-21-40(27-43)22-24-41/h4,6-7,9-20,27,33H,2-3,5,8,21-26H2,1H3 |
| InChIKey | NIIWVWRLCGNULE-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.73 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|