C44H47F3N4O2 — CID 59808313
(E)-N-[(2S)-1-(4-benzylpiperazin-1-yl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 59808313) has the molecular formula C44H47F3N4O2 and a molecular weight of 720.88 g/mol. Its IUPAC name is (E)-N-[(2S)-1-(4-benzylpiperazin-1-yl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(2S)-1-(4-benzylpiperazin-1-yl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59808313 |
| Molecular Formula | C44H47F3N4O2 |
| Molecular Weight | 720.88 g/mol |
| Exact Mass | 720.37 |
| IUPAC Name | (E)-N-[(2S)-1-(4-benzylpiperazin-1-yl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCCCCc1ccc(CN(C(=O)/C=C/c2ccc(C(F)(F)F)cc2)[C@@H](Cc2c[nH]c3ccccc23)C(=O)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C44H47F3N4O2/c1-2-3-5-10-33-15-17-36(18-16-33)32-51(42(52)24-21-34-19-22-38(23-20-34)44(45,46)47)41(29-37-30-48-40-14-9-8-13-39(37)40)43(53)50-27-25-49(26-28-50)31-35-11-6-4-7-12-35/h4,6-9,11-24,30,41,48H,2-3,5,10,25-29,31-32H2,1H3/b24-21+/t41-/m0/s1 |
| InChIKey | WEZCGHGFUPKTGJ-WSKTXXLOSA-N |
| XLogP | 8.92 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.88 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|