C43H49F3N4O2 — CID 143444414
(E)-N-[(2S)-1-oxo-3-phenyl-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide;prop-1-ene (PubChem CID 143444414) has the molecular formula C43H49F3N4O2 and a molecular weight of 710.88 g/mol. Its IUPAC name is (E)-N-[(2S)-1-oxo-3-phenyl-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide;prop-1-ene.
| Compound Name | (E)-N-[(2S)-1-oxo-3-phenyl-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide;prop-1-ene |
|---|---|
| PubChem CID | 143444414 |
| Molecular Formula | C43H49F3N4O2 |
| Molecular Weight | 710.88 g/mol |
| Exact Mass | 710.38 |
| IUPAC Name | (E)-N-[(2S)-1-oxo-3-phenyl-1-(4-pyridin-4-ylpiperazin-1-yl)propan-2-yl]-N-[(4-pentylphenyl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide;prop-1-ene |
| SMILES | C=CC.CCCCCc1ccc(CN(C(=O)/C=C/c2ccc(C(F)(F)F)cc2)[C@@H](Cc2ccccc2)C(=O)N2CCN(c3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C40H43F3N4O2.C3H6/c1-2-3-5-8-31-11-13-34(14-12-31)30-47(38(48)20-17-32-15-18-35(19-16-32)40(41,42)43)37(29-33-9-6-4-7-10-33)39(49)46-27-25-45(26-28-46)36-21-23-44-24-22-36;1-3-2/h4,6-7,9-24,37H,2-3,5,8,25-30H2,1H3;3H,1H2,2H3/b20-17+;/t37-;/m0./s1 |
| InChIKey | DRVDFXQLHVVYBL-REYOJPLXSA-N |
| XLogP | 9.03 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.88 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|