C33H34F3N3O4 — CID 67384535
methyl 2-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoate (PubChem CID 67384535) has the molecular formula C33H34F3N3O4 and a molecular weight of 593.65 g/mol. Its IUPAC name is methyl 2-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 67384535 |
| Molecular Formula | C33H34F3N3O4 |
| Molecular Weight | 593.65 g/mol |
| Exact Mass | 593.25 |
| IUPAC Name | methyl 2-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)N(Cc1ccc(N2CCN(C(C)=O)CC2)cc1)C(=O)C=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H34F3N3O4/c1-24(40)37-18-20-38(21-19-37)29-15-10-27(11-16-29)23-39(30(32(42)43-2)22-26-6-4-3-5-7-26)31(41)17-12-25-8-13-28(14-9-25)33(34,35)36/h3-17,30H,18-23H2,1-2H3 |
| InChIKey | QZTWCGBDPPFGRW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|