C36H42F3N5O3 — CID 67385006
2-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-N-methyl-N-[2-(methylamino)ethyl]-3-phenylpropanamide (PubChem CID 67385006) has the molecular formula C36H42F3N5O3 and a molecular weight of 649.76 g/mol. Its IUPAC name is 2-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-N-methyl-N-[2-(methylamino)ethyl]-3-phenylpropanamide.
| Compound Name | 2-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-N-methyl-N-[2-(methylamino)ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 67385006 |
| Molecular Formula | C36H42F3N5O3 |
| Molecular Weight | 649.76 g/mol |
| Exact Mass | 649.32 |
| IUPAC Name | 2-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-N-methyl-N-[2-(methylamino)ethyl]-3-phenylpropanamide |
| SMILES | CNCCN(C)C(=O)C(Cc1ccccc1)N(Cc1ccc(N2CCN(C(C)=O)CC2)cc1)C(=O)C=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C36H42F3N5O3/c1-27(45)42-21-23-43(24-22-42)32-16-11-30(12-17-32)26-44(34(46)18-13-28-9-14-31(15-10-28)36(37,38)39)33(25-29-7-5-4-6-8-29)35(47)41(3)20-19-40-2/h4-18,33,40H,19-26H2,1-3H3 |
| InChIKey | DRBPSEUVLRMXGN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.76 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|