C39H47F3N4O5 — CID 67385111
tert-butyl N-methyl-N-[2-[methyl-[2-[(4-morpholin-4-ylphenyl)methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]ethyl]carbamate (PubChem CID 67385111) has the molecular formula C39H47F3N4O5 and a molecular weight of 708.82 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[methyl-[2-[(4-morpholin-4-ylphenyl)methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-[methyl-[2-[(4-morpholin-4-ylphenyl)methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 67385111 |
| Molecular Formula | C39H47F3N4O5 |
| Molecular Weight | 708.82 g/mol |
| Exact Mass | 708.35 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[methyl-[2-[(4-morpholin-4-ylphenyl)methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]ethyl]carbamate |
| SMILES | CN(CCN(C)C(=O)C(Cc1ccccc1)N(Cc1ccc(N2CCOCC2)cc1)C(=O)C=Cc1ccc(C(F)(F)F)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H47F3N4O5/c1-38(2,3)51-37(49)44(5)22-21-43(4)36(48)34(27-30-9-7-6-8-10-30)46(28-31-13-18-33(19-14-31)45-23-25-50-26-24-45)35(47)20-15-29-11-16-32(17-12-29)39(40,41)42/h6-20,34H,21-28H2,1-5H3 |
| InChIKey | ZEJRRRBPWYTJNJ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 82.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.82 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|