C32H32F3N3O4 — CID 67384914
2-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoic acid (PubChem CID 67384914) has the molecular formula C32H32F3N3O4 and a molecular weight of 579.62 g/mol. Its IUPAC name is 2-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 67384914 |
| Molecular Formula | C32H32F3N3O4 |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | 2-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(=O)N1CCN(c2ccc(CN(C(=O)C=Cc3ccc(C(F)(F)F)cc3)C(Cc3ccccc3)C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C32H32F3N3O4/c1-23(39)36-17-19-37(20-18-36)28-14-9-26(10-15-28)22-38(29(31(41)42)21-25-5-3-2-4-6-25)30(40)16-11-24-7-12-27(13-8-24)32(33,34)35/h2-16,29H,17-22H2,1H3,(H,41,42) |
| InChIKey | KESRCLFADCADSC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|