C44H50N6O4 — CID 67323877
3-(4-acetamidophenyl)-N-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl]-N-[1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]prop-2-enamide (PubChem CID 67323877) has the molecular formula C44H50N6O4 and a molecular weight of 726.92 g/mol. Its IUPAC name is 3-(4-acetamidophenyl)-N-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl]-N-[1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]prop-2-enamide.
| Compound Name | 3-(4-acetamidophenyl)-N-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl]-N-[1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 67323877 |
| Molecular Formula | C44H50N6O4 |
| Molecular Weight | 726.92 g/mol |
| Exact Mass | 726.39 |
| IUPAC Name | 3-(4-acetamidophenyl)-N-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl]-N-[1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(C=CC(=O)N(Cc2ccc(N3CCN(C(C)=O)CC3)cc2)C(Cc2ccccc2)C(=O)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C44H50N6O4/c1-34(51)45-40-18-13-36(14-19-40)17-22-43(53)50(33-39-15-20-41(21-16-39)48-29-27-47(28-30-48)35(2)52)42(31-37-9-5-3-6-10-37)44(54)49-25-23-46(24-26-49)32-38-11-7-4-8-12-38/h3-22,42H,23-33H2,1-2H3,(H,45,51) |
| InChIKey | HWHYISNRNUSNAL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.92 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|