C45H52ClN5O3 — CID 67323284
N-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl]-N-[1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 67323284) has the molecular formula C45H52ClN5O3 and a molecular weight of 746.40 g/mol. Its IUPAC name is N-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl]-N-[1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | N-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl]-N-[1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 67323284 |
| Molecular Formula | C45H52ClN5O3 |
| Molecular Weight | 746.40 g/mol |
| Exact Mass | 745.38 |
| IUPAC Name | N-[[4-(4-acetylpiperazin-1-yl)phenyl]methyl]-N-[1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-1-oxo-3-phenylpropan-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(=O)N1CCN(c2ccc(CN(C(=O)C=Cc3ccc(C(C)C)cc3)C(Cc3ccccc3)C(=O)N3CCN(Cc4ccc(Cl)cc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C45H52ClN5O3/c1-34(2)40-16-9-36(10-17-40)15-22-44(53)51(33-39-13-20-42(21-14-39)49-29-27-48(28-30-49)35(3)52)43(31-37-7-5-4-6-8-37)45(54)50-25-23-47(24-26-50)32-38-11-18-41(46)19-12-38/h4-22,34,43H,23-33H2,1-3H3 |
| InChIKey | LJOSAHGOGAJYAZ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 67.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.40 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|