C41H47N3O4 — CID 90900767
N-[(2S)-1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-N-[(4-butoxyphenyl)methyl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 90900767) has the molecular formula C41H47N3O4 and a molecular weight of 645.84 g/mol. Its IUPAC name is N-[(2S)-1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-N-[(4-butoxyphenyl)methyl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[(2S)-1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-N-[(4-butoxyphenyl)methyl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90900767 |
| Molecular Formula | C41H47N3O4 |
| Molecular Weight | 645.84 g/mol |
| Exact Mass | 645.36 |
| IUPAC Name | N-[(2S)-1-(4-benzylpiperazin-1-yl)-1-oxo-3-phenylpropan-2-yl]-N-[(4-butoxyphenyl)methyl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | CCCCOc1ccc(CN(C(=O)C=Cc2ccc(OC)cc2)[C@@H](Cc2ccccc2)C(=O)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C41H47N3O4/c1-3-4-29-48-38-22-17-36(18-23-38)32-44(40(45)24-19-33-15-20-37(47-2)21-16-33)39(30-34-11-7-5-8-12-34)41(46)43-27-25-42(26-28-43)31-35-13-9-6-10-14-35/h5-24,39H,3-4,25-32H2,1-2H3/t39-/m0/s1 |
| InChIKey | VKUKKGMZKDGPQM-KDXMTYKHSA-N |
| XLogP | 6.87 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.84 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|