C30H35N3O2S — CID 42710860
N-[[4-(dimethylamino)phenyl]methyl]-N-(1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl)-2-phenylsulfanylacetamide (PubChem CID 42710860) has the molecular formula C30H35N3O2S and a molecular weight of 501.70 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-(1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl)-2-phenylsulfanylacetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-(1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl)-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 42710860 |
| Molecular Formula | C30H35N3O2S |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-(1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl)-2-phenylsulfanylacetamide |
| SMILES | CN(C)c1ccc(CN(C(=O)CSc2ccccc2)C(Cc2ccccc2)C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C30H35N3O2S/c1-31(2)26-17-15-25(16-18-26)22-33(29(34)23-36-27-13-7-4-8-14-27)28(21-24-11-5-3-6-12-24)30(35)32-19-9-10-20-32/h3-8,11-18,28H,9-10,19-23H2,1-2H3 |
| InChIKey | WGRNROCBNMRVOI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|